What is the molecular formula of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The molecular formula is C6H5BF2O3.
What are the synonyms for 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The synonyms are 957065-86-0, 2,6-Difluoro-3-hydroxyphenylboronic acid, (2,6-difluoro-3-hydroxyphenyl)boronic acid, and (2,6-Difluoro-3-hydroxyphenyl)boronic acid.
What is the molecular weight of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The molecular weight is 173.91 g/mol.
What is the IUPAC name of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The IUPAC name is (2,6-difluoro-3-hydroxyphenyl)boronic acid.
What is the InChI of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The InChI is InChI=1S/C6H5BF2O3/c8-3-1-2-4(10)6(9)5(3)7(11)12/h1-2,10-12H.
What is the InChIKey of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The InChIKey is YTKYZCCDBZCCOK-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1F)O)F)(O)O.
What is the CAS number of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The CAS number is 957065-86-0.
What is the European Community (EC) number of 2,6-Difluoro-3-hydroxybenzeneboronic acid?
The European Community (EC) number is 812-160-6.
※ Please kindly note that our products are for research use only.