What is the molecular formula of 2,6-Diethoxytoluene?
The molecular formula of 2,6-Diethoxytoluene is C11H16O2.
What is the molecular weight of 2,6-Diethoxytoluene?
The molecular weight of 2,6-Diethoxytoluene is 180.24 g/mol.
What is the IUPAC name of 2,6-Diethoxytoluene?
The IUPAC name of 2,6-Diethoxytoluene is 1,3-diethoxy-2-methylbenzene.
What is the InChI of 2,6-Diethoxytoluene?
The InChI of 2,6-Diethoxytoluene is InChI=1S/C11H16O2/c1-4-12-10-7-6-8-11(9(10)3)13-5-2/h6-8H,4-5H2,1-3H3.
What is the InChIKey of 2,6-Diethoxytoluene?
The InChIKey of 2,6-Diethoxytoluene is ZJCYULYFGMNBIQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Diethoxytoluene?
The canonical SMILES of 2,6-Diethoxytoluene is CCOC1=C(C(=CC=C1)OCC)C.
What is the CAS number of 2,6-Diethoxytoluene?
The CAS number of 2,6-Diethoxytoluene is 6972-63-0.
What is the European Community (EC) number of 2,6-Diethoxytoluene?
The European Community (EC) number of 2,6-Diethoxytoluene is 622-346-7.
What is the DSSTox Substance ID of 2,6-Diethoxytoluene?
The DSSTox Substance ID of 2,6-Diethoxytoluene is DTXSID80289598.
What is the molecular weight, XLogP3 value, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, and topological polar surface area of 2,6-Diethoxytoluene?
The molecular weight of 2,6-Diethoxytoluene is 180.24 g/mol.
The XLogP3 value of 2,6-Diethoxytoluene is 3.6.
The hydrogen bond donor count of 2,6-Diethoxytoluene is 0.
The hydrogen bond acceptor count of 2,6-Diethoxytoluene is 2.
The rotatable bond count of 2,6-Diethoxytoluene is 4.
The topological polar surface area of 2,6-Diethoxytoluene is 18.5Ų.