What is the molecular formula of 2,6-Dichloroiodobenzene?
The molecular formula of 2,6-Dichloroiodobenzene is C6H3Cl2I.
What is the molecular weight of 2,6-Dichloroiodobenzene?
The molecular weight of 2,6-Dichloroiodobenzene is 272.89 g/mol.
What is the IUPAC name of 2,6-Dichloroiodobenzene?
The IUPAC name of 2,6-Dichloroiodobenzene is 1,3-dichloro-2-iodobenzene.
What is the InChI of 2,6-Dichloroiodobenzene?
The InChI of 2,6-Dichloroiodobenzene is InChI=1S/C6H3Cl2I/c7-4-2-1-3-5(8)6(4)9/h1-3H.
What is the InChIKey of 2,6-Dichloroiodobenzene?
The InChIKey of 2,6-Dichloroiodobenzene is ZMPGXSFTXBOKFM-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2,6-Dichloroiodobenzene?
The canonical SMILES representation of 2,6-Dichloroiodobenzene is C1=CC(=C(C(=C1)Cl)I)Cl.
What is the CAS number of 2,6-Dichloroiodobenzene?
The CAS number of 2,6-Dichloroiodobenzene is 19230-28-5.
What is the EC number of 2,6-Dichloroiodobenzene?
The EC number of 2,6-Dichloroiodobenzene is 627-660-8.
What is the PubChem CID of 2,6-Dichloroiodobenzene?
The PubChem CID of 2,6-Dichloroiodobenzene is 140498.
Is 2,6-Dichloroiodobenzene a canonicalized compound?
Yes, 2,6-Dichloroiodobenzene is a canonicalized compound according to PubChem.