184304-54-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,5-Dimethylpyridine-3-boronic acid is C7H10BNO2.
The molecular weight of 2,5-Dimethylpyridine-3-boronic acid is 150.97 g/mol.
The IUPAC name of 2,5-Dimethylpyridine-3-boronic acid is (2,5-dimethylpyridin-3-yl)boronic acid.
The InChI of 2,5-Dimethylpyridine-3-boronic acid is InChI=1S/C7H10BNO2/c1-5-3-7(8(10)11)6(2)9-4-5/h3-4,10-11H,1-2H3.
The InChIKey of 2,5-Dimethylpyridine-3-boronic acid is HIMKPXQJBGSLSM-UHFFFAOYSA-N.
The canonical SMILES of 2,5-Dimethylpyridine-3-boronic acid is B(C1=CC(=CN=C1C)C)(O)O.
The CAS number of 2,5-Dimethylpyridine-3-boronic acid is 1029654-18-9.
2,5-Dimethylpyridine-3-boronic acid has 2 hydrogen bond donor counts.
2,5-Dimethylpyridine-3-boronic acid has 3 hydrogen bond acceptor counts.
Download
×