What is the molecular formula of 2,5-Difluoroaniline?
The molecular formula of 2,5-Difluoroaniline is C6H5F2N.
What is the molecular weight of 2,5-Difluoroaniline?
The molecular weight of 2,5-Difluoroaniline is 129.11 g/mol.
What is the IUPAC name of 2,5-Difluoroaniline?
The IUPAC name of 2,5-Difluoroaniline is 2,5-difluoroaniline.
What is the InChI of 2,5-Difluoroaniline?
The InChI of 2,5-Difluoroaniline is InChI=1S/C6H5F2N/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2.
What is the InChIKey of 2,5-Difluoroaniline?
The InChIKey of 2,5-Difluoroaniline is YNOOQIUSYGWMSS-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Difluoroaniline?
The canonical SMILES of 2,5-Difluoroaniline is C1=CC(=C(C=C1F)N)F.
What is the CAS number of 2,5-Difluoroaniline?
The CAS number of 2,5-Difluoroaniline is 367-30-6.
What is the XLogP3 value of 2,5-Difluoroaniline?
The XLogP3 value of 2,5-Difluoroaniline is 1.5.
Is 2,5-Difluoroaniline a canonicalized compound?
Yes, 2,5-Difluoroaniline is a canonicalized compound.