What is the molecular formula of 2,4-Quinolinediol?
The molecular formula of 2,4-Quinolinediol is C9H7NO2.
What is the molecular weight of 2,4-Quinolinediol?
The molecular weight of 2,4-Quinolinediol is 161.16 g/mol.
What is the IUPAC name of 2,4-Quinolinediol?
The IUPAC name of 2,4-Quinolinediol is 4-hydroxy-1H-quinolin-2-one.
What is the InChI of 2,4-Quinolinediol?
The InChI of 2,4-Quinolinediol is InChI=1S/C9H7NO2/c11-8-5-9(12)10-7-4-2-1-3-6(7)8/h1-5H,(H2,10,11,12).
What is the InChIKey of 2,4-Quinolinediol?
The InChIKey of 2,4-Quinolinediol is HDHQZCHIXUUSMK-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2,4-Quinolinediol?
The canonical SMILES representation of 2,4-Quinolinediol is C1=CC=C2C(=C1)C(=CC(=O)N2)O.
What is the CAS number of 2,4-Quinolinediol?
The CAS number of 2,4-Quinolinediol is 86-95-3.
What is the ChEMBL ID of 2,4-Quinolinediol?
The ChEMBL ID of 2,4-Quinolinediol is CHEMBL223449.
What is the XLogP3-AA value of 2,4-Quinolinediol?
The XLogP3-AA value of 2,4-Quinolinediol is 0.7.
How many hydrogen bond donor count does 2,4-Quinolinediol have?
2,4-Quinolinediol has 2 hydrogen bond donor count.