What is the PubChem CID of 2,4-Difluorotoluene?
The PubChem CID of 2,4-Difluorotoluene is 67983.
What is the molecular formula of 2,4-Difluorotoluene?
The molecular formula of 2,4-Difluorotoluene is C7H6F2.
What is the molecular weight of 2,4-Difluorotoluene?
The molecular weight of 2,4-Difluorotoluene is 128.12 g/mol.
What is the IUPAC name of 2,4-Difluorotoluene?
The IUPAC name of 2,4-Difluorotoluene is 2,4-difluoro-1-methylbenzene.
What is the InChI of 2,4-Difluorotoluene?
The InChI of 2,4-Difluorotoluene is InChI=1S/C7H6F2/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3.
What is the InChIKey of 2,4-Difluorotoluene?
The InChIKey of 2,4-Difluorotoluene is MPXDAIBTYWGBSL-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Difluorotoluene?
The canonical SMILES of 2,4-Difluorotoluene is CC1=C(C=C(C=C1)F)F.
What is the CAS number of 2,4-Difluorotoluene?
The CAS number of 2,4-Difluorotoluene is 452-76-6.
How many hydrogen bond acceptor counts does 2,4-Difluorotoluene have?
2,4-Difluorotoluene has 2 hydrogen bond acceptor counts.
Is 2,4-Difluorotoluene a canonicalized compound?
Yes, 2,4-Difluorotoluene is a canonicalized compound.