13670-99-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,4-Difluorobenzenesulfonyl chloride is C6H3ClF2O2S.
The molecular weight of 2,4-Difluorobenzenesulfonyl chloride is 212.60 g/mol.
The IUPAC name of 2,4-Difluorobenzenesulfonyl chloride is 2,4-difluorobenzenesulfonyl chloride.
The Canonical SMILES representation of 2,4-Difluorobenzenesulfonyl chloride is C1=CC(=C(C=C1F)F)S(=O)(=O)Cl.
The InChIKey of 2,4-Difluorobenzenesulfonyl chloride is FJSAJUXIHJIAMD-UHFFFAOYSA-N.
The XLogP3-AA value of 2,4-Difluorobenzenesulfonyl chloride is 2.1.
2,4-Difluorobenzenesulfonyl chloride has 0 hydrogen bond donor count.
2,4-Difluorobenzenesulfonyl chloride has 4 hydrogen bond acceptor count.
The topological polar surface area of 2,4-Difluorobenzenesulfonyl chloride is 42.5 Å^2.
Yes, 2,4-Difluorobenzenesulfonyl chloride is considered as a canonicalized compound.
Download
×