What is the molecular formula of 2,4-Dichloropyrimidine?
The molecular formula of 2,4-Dichloropyrimidine is C4H2Cl2N2.
What is the molecular weight of 2,4-Dichloropyrimidine?
The molecular weight of 2,4-Dichloropyrimidine is 148.98 g/mol.
What is the IUPAC name of 2,4-Dichloropyrimidine?
The IUPAC name of 2,4-Dichloropyrimidine is 2,4-dichloropyrimidine.
What is the InChI of 2,4-Dichloropyrimidine?
The InChI of 2,4-Dichloropyrimidine is InChI=1S/C4H2Cl2N2/c5-3-1-2-7-4(6)8-3/h1-2H.
What is the InChIKey of 2,4-Dichloropyrimidine?
The InChIKey of 2,4-Dichloropyrimidine is BTTNYQZNBZNDOR-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dichloropyrimidine?
The canonical SMILES of 2,4-Dichloropyrimidine is C1=CN=C(N=C1Cl)Cl.
What is the CAS number of 2,4-Dichloropyrimidine?
The CAS number of 2,4-Dichloropyrimidine is 3934-20-1.
What is the Hydrogen Bond Acceptor Count of 2,4-Dichloropyrimidine?
The Hydrogen Bond Acceptor Count of 2,4-Dichloropyrimidine is 2.
What is the Topological Polar Surface Area of 2,4-Dichloropyrimidine?
The Topological Polar Surface Area of 2,4-Dichloropyrimidine is 25.8 ?2.
What is the Defined Atom Stereocenter Count of 2,4-Dichloropyrimidine?
The Defined Atom Stereocenter Count of 2,4-Dichloropyrimidine is 0.