What is the molecular formula of 2,4-Dichlorobromobenzene?
The molecular formula of 2,4-Dichlorobromobenzene is C6H3BrCl2.
What is the molecular weight of 2,4-Dichlorobromobenzene?
The molecular weight of 2,4-Dichlorobromobenzene is 225.89 g/mol.
What is the IUPAC name of 2,4-Dichlorobromobenzene?
The IUPAC name of 2,4-Dichlorobromobenzene is 1-bromo-2,4-dichlorobenzene.
What is the InChI of 2,4-Dichlorobromobenzene?
The InChI of 2,4-Dichlorobromobenzene is InChI=1S/C6H3BrCl2/c7-5-2-1-4(8)3-6(5)9/h1-3H.
What is the InChIKey of 2,4-Dichlorobromobenzene?
The InChIKey of 2,4-Dichlorobromobenzene is ISHYFWKKWKXXPL-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dichlorobromobenzene?
The canonical SMILES of 2,4-Dichlorobromobenzene is C1=CC(=C(C=C1Cl)Cl)Br.
What is the CAS number of 2,4-Dichlorobromobenzene?
The CAS number of 2,4-Dichlorobromobenzene is 1193-72-2.
What is the European Community (EC) number of 2,4-Dichlorobromobenzene?
The European Community (EC) number of 2,4-Dichlorobromobenzene is 214-778-6.
What is the DSSTox Substance ID of 2,4-Dichlorobromobenzene?
The DSSTox Substance ID of 2,4-Dichlorobromobenzene is DTXSID10152408.
Is 2,4-Dichlorobromobenzene considered a covalently-bonded unit?
Yes, 2,4-Dichlorobromobenzene is considered a covalently-bonded unit.