What is the molecular formula of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The molecular formula is C9H6F6O.
What is the molecular weight of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The molecular weight is 244.13 g/mol.
What is the IUPAC name of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The IUPAC name is [2,4-bis(trifluoromethyl)phenyl]methanol.
What is the InChI of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The InChI is InChI=1S/C9H6F6O/c10-8(11,12)6-2-1-5(4-16)7(3-6)9(13,14)15/h1-3,16H,4H2.
What is the InChIKey of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The InChIKey is NDHDRXKQSOFDNV-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The canonical SMILES is C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CO.
What is the CAS number of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The CAS number is 143158-15-0.
What is the European Community (EC) number of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The EC number is 670-623-6.
What is the hydrogen bond donor count of 2,4-Bis(trifluoromethyl)benzyl alcohol?
The hydrogen bond donor count is 1.
Is 2,4-Bis(trifluoromethyl)benzyl alcohol a canonicalized compound?
Yes, it is a canonicalized compound.