What is the molecular formula of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The molecular formula is C24H15N3O6.
What is the molecular weight of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The molecular weight is 441.4 g/mol.
What is the IUPAC name of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The IUPAC name is 4-[4,6-bis(4-carboxyphenyl)-1,3,5-triazin-2-yl]benzoic acid.
What is the InChI of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The InChI is InChI=1S/C24H15N3O6/c28-22(29)16-7-1-13(2-8-16)19-25-20(14-3-9-17(10-4-14)23(30)31)27-21(26-19)15-5-11-18(12-6-15)24(32)33/h1-12H,(H,28,29)(H,30,31)(H,32,33).
What is the InChIKey of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The InChIKey is MSFXUHUYNSYIDR-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The canonical SMILES is C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O).
What is the CAS number of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The CAS number is 61414-16-2.
What is the European Community (EC) Number of 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine?
The European Community (EC) Number is 689-419-3.
Is 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine a covalently-bonded unit?
Yes, it is a covalently-bonded unit.
※ Please kindly note that our products are for research use only.