What is the molecular formula of stigmatellin a according to PubChem CID 447884?
The molecular formula of stigmatellin a is C30H42O7.
What is the molecular weight of stigmatellin a?
The molecular weight of stigmatellin a is 514.6 g/mol.
What is the IUPAC name of stigmatellin a?
The IUPAC name of stigmatellin a is 2-[(3S,4S,5S,6S,7E,9E,11E)-4,6-dimethoxy-3,5,11-trimethyltrideca-7,9,11-trienyl]-8-hydroxy-5,7-dimethoxy-3-methylchromen-4-one.
What is the InChI of stigmatellin a?
The InChI of stigmatellin a is InChI=1S/C30H42O7/c1-10-18(2)13-11-12-14-22(33-6)21(5)29(36-9)19(3)15-16-23-20(4)27(31)26-24(34-7)17-25(35-8)28(32)30(26)37-23/h10-14,17,19,21-22,29,32H,15-16H2,1-9H3/b13-11+,14-12+,18-10+/t19-,21+,22-,29-/m0/s1.
What is the InChIKey of stigmatellin a?
The InChIKey of stigmatellin a is UZHDGDDPOPDJGM-CVOZLMQJSA-N.
How many hydrogen bond donor counts does stigmatellin a have?
Stigmatellin a has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does stigmatellin a have?
Stigmatellin a has 7 hydrogen bond acceptor counts.
How many rotatable bond counts does stigmatellin a have?
Stigmatellin a has 13 rotatable bond counts.
What is the exact mass of stigmatellin a?
The exact mass of stigmatellin a is 514.29305367 g/mol.
What is the topological polar surface area of stigmatellin a?
The topological polar surface area of stigmatellin a is 83.4 Ų.
※ Please kindly note that our products are for research use only.