The molecular formula of the compound is C12H17NO2.
What are the synonyms for the compound?
The synonyms for the compound are 10429-30-8, 2-[3-(dimethylamino)propoxy]benzaldehyde, 2-(3-(Dimethylamino)propoxy)benzaldehyde, 2-(3-Dimethylaminopropoxy)benzaldehyde, and more.
What is the molecular weight of the compound?
The molecular weight of the compound is 207.27 g/mol.
When was the compound created?
The compound was created on July 29, 2005.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-[3-(dimethylamino)propoxy]benzaldehyde.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C12H17NO2/c1-13(2)8-5-9-15-12-7-4-3-6-11(12)10-14/h3-4,6-7,10H,5,8-9H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is DSHCOEWHRLVOTF-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CN(C)CCCOC1=CC=CC=C1C=O.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 2.1.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.