What is the molecular formula of 2,3-Difluoro-6-ethoxyphenylboronic acid?
The molecular formula of 2,3-Difluoro-6-ethoxyphenylboronic acid is C8H9BF2O3.
What are the synonyms for 2,3-Difluoro-6-ethoxyphenylboronic acid?
The synonyms for 2,3-Difluoro-6-ethoxyphenylboronic acid include (6-Ethoxy-2,3-difluorophenyl)boronic acid and Boronic acid, B-(6-ethoxy-2,3-difluorophenyl)-.
What is the molecular weight of 2,3-Difluoro-6-ethoxyphenylboronic acid?
The molecular weight of 2,3-Difluoro-6-ethoxyphenylboronic acid is 201.97 g/mol.
What is the IUPAC name of 2,3-Difluoro-6-ethoxyphenylboronic acid?
The IUPAC name of 2,3-Difluoro-6-ethoxyphenylboronic acid is (6-ethoxy-2,3-difluorophenyl)boronic acid.
What is the InChI of 2,3-Difluoro-6-ethoxyphenylboronic acid?
The InChI of 2,3-Difluoro-6-ethoxyphenylboronic acid is InChI=1S/C8H9BF2O3/c1-2-14-6-4-3-5(10)8(11)7(6)9(12)13/h3-4,12-13H,2H2,1H3.
What is the InChIKey of 2,3-Difluoro-6-ethoxyphenylboronic acid?
The InChIKey of 2,3-Difluoro-6-ethoxyphenylboronic acid is KVSMPXUZSFLBMK-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Difluoro-6-ethoxyphenylboronic acid?
The canonical SMILES of 2,3-Difluoro-6-ethoxyphenylboronic acid is B(C1=C(C=CC(=C1F)F)OCC)(O)O.
How many hydrogen bond donor counts does 2,3-Difluoro-6-ethoxyphenylboronic acid have?
2,3-Difluoro-6-ethoxyphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,3-Difluoro-6-ethoxyphenylboronic acid have?
2,3-Difluoro-6-ethoxyphenylboronic acid has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 2,3-Difluoro-6-ethoxyphenylboronic acid have?
2,3-Difluoro-6-ethoxyphenylboronic acid has 3 rotatable bond counts.
※ Please kindly note that our products are for research use only.