What is the molecular formula of 2,3-Dichlorobenzoic acid?
The molecular formula of 2,3-Dichlorobenzoic acid is C7H4Cl2O2.
What is the molecular weight of 2,3-Dichlorobenzoic acid?
The molecular weight of 2,3-Dichlorobenzoic acid is 191.01 g/mol.
What is the IUPAC name of 2,3-Dichlorobenzoic acid?
The IUPAC name of 2,3-Dichlorobenzoic acid is 2,3-dichlorobenzoic acid.
What is the InChIKey of 2,3-Dichlorobenzoic acid?
The InChIKey of 2,3-Dichlorobenzoic acid is QAOJBHRZQQDFHA-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dichlorobenzoic acid?
The canonical SMILES of 2,3-Dichlorobenzoic acid is C1=CC(=C(C(=C1)Cl)Cl)C(=O)O.
What is the CAS number of 2,3-Dichlorobenzoic acid?
The CAS number of 2,3-Dichlorobenzoic acid is 50-45-3.
What is the European Community (EC) number of 2,3-Dichlorobenzoic acid?
The European Community (EC) number of 2,3-Dichlorobenzoic acid is 200-039-5.
What is the ChEMBL ID of 2,3-Dichlorobenzoic acid?
The ChEMBL ID of 2,3-Dichlorobenzoic acid is CHEMBL1353833.
What is the monoisotopic mass of 2,3-Dichlorobenzoic acid?
The monoisotopic mass of 2,3-Dichlorobenzoic acid is 189.9588348 g/mol.
How many hydrogen bond donor counts does 2,3-Dichlorobenzoic acid have?
2,3-Dichlorobenzoic acid has 1 hydrogen bond donor count.