What is the molecular formula of 2,3-Diaminofluorobenzene?
The molecular formula of 2,3-Diaminofluorobenzene is C6H7FN2.
What is the molecular weight of 2,3-Diaminofluorobenzene?
The molecular weight of 2,3-Diaminofluorobenzene is 126.13 g/mol.
What is the IUPAC name of 2,3-Diaminofluorobenzene?
The IUPAC name of 2,3-Diaminofluorobenzene is 3-fluorobenzene-1,2-diamine.
What is the InChI of 2,3-Diaminofluorobenzene?
The InChI of 2,3-Diaminofluorobenzene is InChI=1S/C6H7FN2/c7-4-2-1-3-5(8)6(4)9/h1-3H,8-9H2.
What is the InChIKey of 2,3-Diaminofluorobenzene?
The InChIKey of 2,3-Diaminofluorobenzene is OJSCBKGRGMBEEW-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Diaminofluorobenzene?
The canonical SMILES of 2,3-Diaminofluorobenzene is C1=CC(=C(C(=C1)F)N)N.
What is the CAS number of 2,3-Diaminofluorobenzene?
The CAS number of 2,3-Diaminofluorobenzene is 18645-88-0.
What is the European Community (EC) number of 2,3-Diaminofluorobenzene?
The European Community (EC) number of 2,3-Diaminofluorobenzene is 848-333-8.
What is the DSSTox Substance ID of 2,3-Diaminofluorobenzene?
The DSSTox Substance ID of 2,3-Diaminofluorobenzene is DTXSID10382329.
Is 2,3-Diaminofluorobenzene a canonicalized compound?
Yes, 2,3-Diaminofluorobenzene is a canonicalized compound according to PubChem.