What is the molecular formula of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The molecular formula is C7H8Cl3N.
What is the molecular weight of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The molecular weight is 212.5 g/mol.
What is the IUPAC name of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The IUPAC name is 2,3-bis(chloromethyl)pyridine;hydrochloride.
What is the InChI of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The InChI is InChI=1S/C7H7Cl2N.ClH/c8-4-6-2-1-3-10-7(6)5-9;/h1-3H,4-5H2;1H.
What is the InChIKey of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The InChIKey is ODUGCZCPPAKASB-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The canonical SMILES is C1=CC(=C(N=C1)CCl)CCl.Cl.
What is the hydrogen bond donor count of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The hydrogen bond acceptor count is 1.
How many rotatable bonds are there in 2,3-Bis(chloromethyl)pyridinehydrochloride?
There are 2 rotatable bonds.
What is the topological polar surface area of 2,3-Bis(chloromethyl)pyridinehydrochloride?
The topological polar surface area is 12.9 Ų.