What is the molecular formula of 2,3,4-Trimethylphenol?
The molecular formula of 2,3,4-Trimethylphenol is C9H12O.
What is the molecular weight of 2,3,4-Trimethylphenol?
The molecular weight of 2,3,4-Trimethylphenol is 136.19 g/mol.
What is the IUPAC name of 2,3,4-Trimethylphenol?
The IUPAC name of 2,3,4-Trimethylphenol is 2,3,4-trimethylphenol.
What is the InChI of 2,3,4-Trimethylphenol?
The InChI of 2,3,4-Trimethylphenol is InChI=1S/C9H12O/c1-6-4-5-9(10)8(3)7(6)2/h4-5,10H,1-3H3.
What is the InChIKey of 2,3,4-Trimethylphenol?
The InChIKey of 2,3,4-Trimethylphenol is XRUGBBIQLIVCSI-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,3,4-Trimethylphenol?
The Canonical SMILES of 2,3,4-Trimethylphenol is CC1=C(C(=C(C=C1)O)C)C.
What is the CAS number of 2,3,4-Trimethylphenol?
The CAS number of 2,3,4-Trimethylphenol is 526-85-2.
What is the European Community (EC) number of 2,3,4-Trimethylphenol?
The European Community (EC) number of 2,3,4-Trimethylphenol is 208-399-5.
What is the UNII of 2,3,4-Trimethylphenol?
The UNII of 2,3,4-Trimethylphenol is 9295A0BC1N.
What is the XLogP3-AA value of 2,3,4-Trimethylphenol?
The XLogP3-AA value of 2,3,4-Trimethylphenol is 2.7.