What is the molecular formula of 2,3,4,5,6-Pentafluorophenylacetic acid?
The molecular formula of 2,3,4,5,6-Pentafluorophenylacetic acid is C8H3F5O2.
What is the molecular weight of 2,3,4,5,6-Pentafluorophenylacetic acid?
The molecular weight of 2,3,4,5,6-Pentafluorophenylacetic acid is 226.10 g/mol.
What is the IUPAC name of 2,3,4,5,6-Pentafluorophenylacetic acid?
The IUPAC name of 2,3,4,5,6-Pentafluorophenylacetic acid is 2-(2,3,4,5,6-pentafluorophenyl)acetic acid.
What is the InChI of 2,3,4,5,6-Pentafluorophenylacetic acid?
The InChI of 2,3,4,5,6-Pentafluorophenylacetic acid is InChI=1S/C8H3F5O2/c9-4-2(1-3(14)15)5(10)7(12)8(13)6(4)11/h1H2,(H,14,15).
What is the InChIKey of 2,3,4,5,6-Pentafluorophenylacetic acid?
The InChIKey of 2,3,4,5,6-Pentafluorophenylacetic acid is LGCODSNZJOVMHV-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3,4,5,6-Pentafluorophenylacetic acid?
The canonical SMILES of 2,3,4,5,6-Pentafluorophenylacetic acid is C(C1=C(C(=C(C(=C1F)F)F)F)F)C(=O)O.
What is the CAS number of 2,3,4,5,6-Pentafluorophenylacetic acid?
The CAS number of 2,3,4,5,6-Pentafluorophenylacetic acid is 653-21-4.
What is the European Community (EC) number of 2,3,4,5,6-Pentafluorophenylacetic acid?
The European Community (EC) number of 2,3,4,5,6-Pentafluorophenylacetic acid is 211-497-0.
What is the UNII of 2,3,4,5,6-Pentafluorophenylacetic acid?
The UNII of 2,3,4,5,6-Pentafluorophenylacetic acid is F2HFR5VJK7.
What is the XLogP3-AA value of 2,3,4,5,6-Pentafluorophenylacetic acid?
The XLogP3-AA value of 2,3,4,5,6-Pentafluorophenylacetic acid is 1.9.