--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H13NO.
The molecular weight of the compound is 187.24 g/mol.
The IUPAC name of the compound is 2-naphthalen-2-yloxyethanamine.
The InChI of the compound is InChI=1S/C12H13NO/c13-7-8-14-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8,13H2.
The InChIKey of the compound is NGOMYFUIWZJUET-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1=CC=C2C=C(C=CC2=C1)OCCN.
The CAS number of the compound is 23314-24-1.
The EC number of the compound is 802-151-5.
The XLogP3 value of the compound is 2.5.
Yes, the compound is canonicalized.
Download
×