What is the molecular formula of 2,2-Dithiosalicylic acid?
The molecular formula of 2,2-Dithiosalicylic acid is C14H10O4S2.
What is the molecular weight of 2,2-Dithiosalicylic acid?
The molecular weight of 2,2-Dithiosalicylic acid is 306.4 g/mol.
What is the IUPAC name of 2,2-Dithiosalicylic acid?
The IUPAC name of 2,2-Dithiosalicylic acid is 2-[(2-carboxyphenyl)disulfanyl]benzoic acid.
What is the InChI of 2,2-Dithiosalicylic acid?
The InChI of 2,2-Dithiosalicylic acid is InChI=1S/C14H10O4S2/c15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18/h1-8H,(H,15,16)(H,17,18).
What is the InChIKey of 2,2-Dithiosalicylic acid?
The InChIKey of 2,2-Dithiosalicylic acid is LBEMXJWGHIEXRA-UHFFFAOYSA-N.
What is the canonical SMILES of 2,2-Dithiosalicylic acid?
The canonical SMILES of 2,2-Dithiosalicylic acid is C1=CC=C(C(=C1)C(=O)O)SSC2=CC=CC=C2C(=O)O.
What is the CAS number of 2,2-Dithiosalicylic acid?
The CAS number of 2,2-Dithiosalicylic acid is 119-80-2.
What is the European Community (EC) number of 2,2-Dithiosalicylic acid?
The European Community (EC) number of 2,2-Dithiosalicylic acid is 204-352-8.
What is the UNII of 2,2-Dithiosalicylic acid?
The UNII of 2,2-Dithiosalicylic acid is 58MGB5279D.
What is the ChEMBL ID of 2,2-Dithiosalicylic acid?
The ChEMBL ID of 2,2-Dithiosalicylic acid is CHEMBL118378.