What is the molecular formula of 2,2':5',2''-Terthiophene?
The molecular formula of 2,2':5',2''-Terthiophene is C12H8S3.
What is the molecular weight of 2,2':5',2''-Terthiophene?
The molecular weight of 2,2':5',2''-Terthiophene is 248.4 g/mol.
What is the IUPAC name of 2,2':5',2''-Terthiophene?
The IUPAC name of 2,2':5',2''-Terthiophene is 2,5-dithiophen-2-ylthiophene.
What is the InChI of 2,2':5',2''-Terthiophene?
The InChI of 2,2':5',2''-Terthiophene is InChI=1S/C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10/h1-8H.
What is the InChIKey of 2,2':5',2''-Terthiophene?
The InChIKey of 2,2':5',2''-Terthiophene is KXSFECAJUBPPFE-UHFFFAOYSA-N.
What is the canonical SMILES of 2,2':5',2''-Terthiophene?
The canonical SMILES of 2,2':5',2''-Terthiophene is C1=CSC(=C1)C2=CC=C(S2)C3=CC=CS3.
What is the CAS number of 2,2':5',2''-Terthiophene?
The CAS number of 2,2':5',2''-Terthiophene is 1081-34-1.
What is the European Community (EC) number of 2,2':5',2''-Terthiophene?
The European Community (EC) number of 2,2':5',2''-Terthiophene is 640-441-1.
What is the ChEMBL ID of 2,2':5',2''-Terthiophene?
The ChEMBL ID of 2,2':5',2''-Terthiophene is CHEMBL90017.
What is the Wikipedia page of 2,2':5',2''-Terthiophene?
The Wikipedia page of 2,2':5',2''-Terthiophene is Terthiophene.