What is the molecular formula of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The molecular formula is C10H19NO4.
What are the synonyms of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The synonyms include (R)-N-(1-Carboxyethyl)-D-norvaline 1-Ethyl Ester, MFCD07782126, 145682-38-8, N-(1-ethoxy-1-oxopentan-2-yl)alanine, SCHEMBL4458272.
What is the molecular weight of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The molecular weight is 217.26 g/mol.
What is the IUPAC name of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The IUPAC name is 2-[(1-ethoxy-1-oxopentan-2-yl)amino]propanoic acid.
What is the InChI of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The InChI is InChI=1S/C10H19NO4/c1-4-6-8(10(14)15-5-2)11-7(3)9(12)13/h7-8,11H,4-6H2,1-3H3,(H,12,13).
What is the InChIKey of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The InChIKey is AUVAVXHAOCLQBF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The canonical SMILES is CCCC(C(=O)OCC)NC(C)C(=O)O.
What is the hydrogen bond donor count of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The hydrogen bond acceptor count is 5.
What is the rotatable bond count of 2-(1-Carboxyethylamino)-pentacoic acid ethyl ester?
The rotatable bond count is 8.
※ Please kindly note that our products are for research use only.