What is the molecular formula of 1R-Cis-Permethrinic Acid?
The molecular formula of 1R-Cis-Permethrinic Acid is C8H10Cl2O2.
What is the molecular weight of 1R-Cis-Permethrinic Acid?
The molecular weight of 1R-Cis-Permethrinic Acid is 209.07 g/mol.
What is the IUPAC name of 1R-Cis-Permethrinic Acid?
The IUPAC name of 1R-Cis-Permethrinic Acid is 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
What is the InChI of 1R-Cis-Permethrinic Acid?
The InChI of 1R-Cis-Permethrinic Acid is InChI=1S/C8H10Cl2O2/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3,(H,11,12).
What is the InChIKey of 1R-Cis-Permethrinic Acid?
The InChIKey of 1R-Cis-Permethrinic Acid is LLMLSUSAKZVFOA-UHFFFAOYSA-N.
What is the canonical SMILES of 1R-Cis-Permethrinic Acid?
The canonical SMILES of 1R-Cis-Permethrinic Acid is CC1(C(C1C(=O)O)C=C(Cl)Cl)C.
What is the CAS number of 1R-Cis-Permethrinic Acid?
The CAS number of 1R-Cis-Permethrinic Acid is 55701-05-8.
What is the monosodium salt related CAS number of 1R-Cis-Permethrinic Acid?
The monosodium salt related CAS number of 1R-Cis-Permethrinic Acid is 57112-15-9.
What is the XLogP3 value of 1R-Cis-Permethrinic Acid?
The XLogP3 value of 1R-Cis-Permethrinic Acid is 3.3.
What is the hydrogen bond donor count of 1R-Cis-Permethrinic Acid?
The hydrogen bond donor count of 1R-Cis-Permethrinic Acid is 1.