The IUPAC name of neamine is (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol.
What is the InChI of neamine?
The InChI of neamine is InChI=1S/C12H26N4O6/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20/h3-12,17-20H,1-2,13-16H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1.
What is the canonical SMILES of neamine?
The canonical SMILES of neamine is C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)N)O)O)N.
What is the CAS number of neamine?
The CAS number of neamine is 3947-65-7.
What is the UNII of neamine?
The UNII of neamine is 5981U00LY0.
What is the ChEMBL ID of neamine?
The ChEMBL ID of neamine is CHEMBL427409.
What is the NCI Thesaurus Code of neamine?
The NCI Thesaurus Code of neamine is C76155.
What is the topological polar surface area of neamine?
The topological polar surface area of neamine is 204 ?2.
※ Please kindly note that our products are for research use only.