What is the molecular formula of the compound?
The molecular formula is C7H7N3.
What is the molecular weight of the compound?
The molecular weight is 133.15 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 1H-indazol-4-amine.
What is the InChI of the compound?
The InChI is InChI=1S/C7H7N3/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H,8H2,(H,9,10).
What is the InChIKey of the compound?
The InChIKey is MDELYEBAXHZXLZ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is C1=CC(=C2C=NNC2=C1)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 0.9.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 0 rotatable bond counts.