What is the molecular formula of 1H-Indazol-3-amine?
The molecular formula is C7H7N3.
What is the molecular weight of 1H-Indazol-3-amine?
The molecular weight is 133.15 g/mol.
What is the IUPAC name of 1H-Indazol-3-amine?
The IUPAC name is 1H-indazol-3-amine.
What is the InChI of 1H-Indazol-3-amine?
The InChI is InChI=1S/C7H7N3/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H3,8,9,10).
What is the InChIKey of 1H-Indazol-3-amine?
The InChIKey is YDTDKKULPWTHRV-UHFFFAOYSA-N.
What is the canonical SMILES of 1H-Indazol-3-amine?
The canonical SMILES is C1=CC=C2C(=C1)C(=NN2)N.
What is the CAS number of 1H-Indazol-3-amine?
The CAS number is 874-05-5.
What is the EC number of 1H-Indazol-3-amine?
The EC number is 692-411-2.
What is the ChEMBL ID of 1H-Indazol-3-amine?
The ChEMBL ID is CHEMBL1331627.
Is 1H-Indazol-3-amine a canonicalized compound?
Yes, 1H-Indazol-3-amine is a canonicalized compound.