1H,1H,7H-Dodecafluoroheptyl acrylate

• CAS: 2993-85-3
• Catalog Number: ACM2993853
• Category: Polymer/Macromolecule
• Molecular Weight: 386.13
• Molecular Formula: C₁₀H₆F₁₂O₂
• Synonyms: TRIHYDROPERFLUOROHEPTYL ACRYLATE;acrylicacid1H,1H,7H-dodecafluoro-heptylester;acrylicacid2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-heptylester;DAIKIN R-5610;2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUOROHEPTYL ACRYLATE;1H,1H,7H-PERFLUOROHEPTYL ACRYLATE;1H,1H,7H-DODECAFL

Custom Q&A

What is the molecular formula of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The molecular formula is C10H6F12O2.

What is the molecular weight of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The molecular weight is 386.13 g/mol.

What is the IUPAC name of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl prop-2-enoate.

What is the InChI of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The InChI is InChI=1S/C10H6F12O2/c1-2-4(23)24-3-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h2,5H,1,3H2.

What is the InChIKey of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The InChIKey is QJEJDNMGOWJONG-UHFFFAOYSA-N.

What is the canonical SMILES of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The canonical SMILES is C=CC(=O)OCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.

What is the CAS number of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The CAS number is 2993-85-3.

What is the XLogP3-AA value of 1H,1H,7H-Dodecafluoroheptyl acrylate?

The XLogP3-AA value is 4.9.

How many hydrogen bond donor count does 1H,1H,7H-Dodecafluoroheptyl acrylate have?

It has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does 1H,1H,7H-Dodecafluoroheptyl acrylate have?

It has 14 hydrogen bond acceptor count.