What is the molecular formula of the compound?
The molecular formula of the compound is C20H27NO2.
What are the synonyms of the compound?
The synonyms of the compound are (8R,9S,10R,13S,14S,17S)-17-Hydroxy-10,13-dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile, 38394-98-8, and SCHEMBL11062192.
What is the molecular weight of the compound?
The molecular weight of the compound is 313.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C20H27NO2/c1-18-8-5-14(22)11-13(18)3-4-15-16(18)6-9-19(2)17(15)7-10-20(19,23)12-21/h11,15-17,23H,3-10H2,1-2H3/t15-,16+,17+,18+,19+,20-/m1/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is JYCSLUASXDFIEL-MPRNQXESSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4(C#N)O)C.
What is the isomeric SMILES of the compound?
The isomeric SMILES of the compound is C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C#N)O)C.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.