What is the molecular formula of 17a-Hydroxy progesterone-21-acetate?
The molecular formula of 17a-Hydroxy progesterone-21-acetate is C23H32O5.
What is the molecular weight of 17a-Hydroxy progesterone-21-acetate?
The molecular weight of 17a-Hydroxy progesterone-21-acetate is 388.5 g/mol.
What is the IUPAC name of 17a-Hydroxy progesterone-21-acetate?
The IUPAC name of 17a-Hydroxy progesterone-21-acetate is [2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
What is the InChI of 17a-Hydroxy progesterone-21-acetate?
The InChI of 17a-Hydroxy progesterone-21-acetate is InChI=1S/C23H32O5/c1-14(24)28-13-20(26)23(27)11-8-19-17-5-4-15-12-16(25)6-9-21(15,2)18(17)7-10-22(19,23)3/h12,17-19,27H,4-11,13H2,1-3H3/t17-,18+,19+,21+,22+,23+/m1/s1.
What is the InChIKey of 17a-Hydroxy progesterone-21-acetate?
The InChIKey of 17a-Hydroxy progesterone-21-acetate is HPAKILCZTKWIFK-JZTHCNPZSA-N.
What is the canonical SMILES of 17a-Hydroxy progesterone-21-acetate?
The canonical SMILES of 17a-Hydroxy progesterone-21-acetate is CC(=O)OCC(=O)C1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O.
What is the CAS number of 17a-Hydroxy progesterone-21-acetate?
The CAS number of 17a-Hydroxy progesterone-21-acetate is 640-87-9.
What is the European Community (EC) number of 17a-Hydroxy progesterone-21-acetate?
The European Community (EC) number of 17a-Hydroxy progesterone-21-acetate is 211-369-4.
What is the UNII of 17a-Hydroxy progesterone-21-acetate?
The UNII of 17a-Hydroxy progesterone-21-acetate is WYH4TKR3TF.
What is the XLogP3 value of 17a-Hydroxy progesterone-21-acetate?
The XLogP3 value of 17a-Hydroxy progesterone-21-acetate is 2.5.