What is the molecular formula of 16a,17a-Epoxyprogesterone?
The molecular formula of 16a,17a-Epoxyprogesterone is C21H28O3.
What is the PubChem CID of 16a,17a-Epoxyprogesterone?
The PubChem CID of 16a,17a-Epoxyprogesterone is 101966.
When was 16a,17a-Epoxyprogesterone created in PubChem?
16a,17a-Epoxyprogesterone was created in PubChem on 2005-03-26.
What is the molecular weight of 16a,17a-Epoxyprogesterone?
The molecular weight of 16a,17a-Epoxyprogesterone is 328.4 g/mol.
What is the IUPAC Name of 16a,17a-Epoxyprogesterone?
The IUPAC Name of 16a,17a-Epoxyprogesterone is (1R,2S,4R,6S,7S,10S,11R)-6-acetyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one.
What is the InChI key of 16a,17a-Epoxyprogesterone?
The InChI key of 16a,17a-Epoxyprogesterone is LHNVKVKZPHUYQO-SRWWVFQWSA-N.
What is the Canonical SMILES of 16a,17a-Epoxyprogesterone?
The Canonical SMILES of 16a,17a-Epoxyprogesterone is CC(=O)C12C(O1)CC3C2(CCC4C3CCC5=CC(=O)CCC45C).
What is the CAS number of 16a,17a-Epoxyprogesterone?
The CAS number of 16a,17a-Epoxyprogesterone is 1097-51-4.
What is the KEGG ID of 16a,17a-Epoxyprogesterone?
The KEGG ID of 16a,17a-Epoxyprogesterone is C14681.
What is the XLogP3-AA value of 16a,17a-Epoxyprogesterone?
The XLogP3-AA value of 16a,17a-Epoxyprogesterone is 2.9.
※ Please kindly note that our products are for research use only.