What is the PubChem CID for 16-Beta methyl epoxide?
The PubChem CID for 16-Beta methyl epoxide is 101933.
What is the molecular formula of 16-Beta methyl epoxide?
The molecular formula of 16-Beta methyl epoxide is C22H28O5.
What is the molecular weight of 16-Beta methyl epoxide?
The molecular weight of 16-Beta methyl epoxide is 372.5 g/mol.
What is the IUPAC name of 16-Beta methyl epoxide?
The IUPAC name of 16-Beta methyl epoxide is (1S,2S,10S,11S,13S,14R,15S,17S)-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.0 1,17 .0 2,7 .0 11,15 ]octadeca-3,6-dien-5-one.
What is the InChI of 16-Beta methyl epoxide?
The InChI of 16-Beta methyl epoxide is InChI=1S/C22H28O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-19(13,2)22(15)18(27-22)10-20(16,3)21(12,26)17(25)11-23/h6-7,9,12,15-16,18,23,26H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,18-,19-,20-,21-,22+/m0/s1.
What is the InChIKey of 16-Beta methyl epoxide?
The InChIKey of 16-Beta methyl epoxide is GBDXNHBVYAMODG-DEGNENOVSA-N.
What is the canonical SMILES of 16-Beta methyl epoxide?
The canonical SMILES of 16-Beta methyl epoxide is CC1CC2C3CCC4=CC(=O)C=CC4(C35C(O5)CC2(C1(C(=O)CO)O)C)C.
What is the CAS number of 16-Beta methyl epoxide?
The CAS number of 16-Beta methyl epoxide is 981-34-0.
What is the European Community (EC) number of 16-Beta methyl epoxide?
The European Community (EC) number of 16-Beta methyl epoxide is 213-563-4.
What is the molecular complexity of 16-Beta methyl epoxide?
The molecular complexity of 16-Beta methyl epoxide is 814.