Metal Plating, Electropolishing, Metal Reprocessing, Phase transfer media, Batteries Fuel Cells, Nanomaterials, Industrial Solvents, Nuclear Fuel Red Waste, Enzymatic Catalysis, Lubricants Heat Transfer and Solar Energy Conversion.
I have bought 1-tetradecyl-3-methylimidazolium hexafluorophosphate many times and the quality is good.
What is the PubChem CID of the compound?
The PubChem CID of the compound is 60196381.
What is the molecular formula of the compound?
The molecular formula of the compound is C18H35F6N2P.
What are the synonyms of the compound?
The synonyms of the compound are 1-Methyl-3-tetradecylimidazolium hexafluorophosphate, 219947-94-1, DTXSID4049248, and 1-Methyl-3-tetradecyl-1H-imidazol-3-ium hexafluorophosphate(V).
What is the molecular weight of the compound?
The molecular weight of the compound is 424.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-methyl-3-tetradecylimidazol-1-ium;hexafluorophosphate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C18H35N2.F6P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-20-17-16-19(2)18-20;1-7(2,3,4,5)6/h16-18H,3-15H2,1-2H3;/q+1;-1.
What is the InChIKey of the compound?
The InChIKey of the compound is VYARLXKWHFGQBN-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCCCCCCCCCCCCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F.
What is the CAS number of the compound?
The CAS number of the compound is 219947-94-1.
What is the ChEMBL ID of the compound?
The ChEMBL ID of the compound is CHEMBL3189114.
※ Please kindly note that our products are for research use only.
Download
