What is the molecular formula of 1-Pentyn-3-ol?
The molecular formula of 1-Pentyn-3-ol is C5H8O.
What is the molecular weight of 1-Pentyn-3-ol?
The molecular weight of 1-Pentyn-3-ol is 84.12 g/mol.
What is the IUPAC name of 1-Pentyn-3-ol?
The IUPAC name of 1-Pentyn-3-ol is pent-1-yn-3-ol.
What is the InChI of 1-Pentyn-3-ol?
The InChI of 1-Pentyn-3-ol is InChI=1S/C5H8O/c1-3-5(6)4-2/h1,5-6H,4H2,2H3.
What is the InChIKey of 1-Pentyn-3-ol?
The InChIKey of 1-Pentyn-3-ol is LBSKEFWQPNVWTP-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Pentyn-3-ol?
The canonical SMILES of 1-Pentyn-3-ol is CCC(C#C)O.
What is the CAS number of 1-Pentyn-3-ol?
The CAS number of 1-Pentyn-3-ol is 4187-86-4.
What is the European Community (EC) number of 1-Pentyn-3-ol?
The European Community (EC) number of 1-Pentyn-3-ol is 224-063-0.
What is the DSSTox Substance ID of 1-Pentyn-3-ol?
The DSSTox Substance ID of 1-Pentyn-3-ol is DTXSID50871060.
Is 1-Pentyn-3-ol the canonicalized form?
Yes, 1-Pentyn-3-ol is the canonicalized form according to PubChem.