What is the molecular formula of the compound described in the reference?
The molecular formula is C19H28BNO4.
What are the synonyms for the compound?
The synonyms include tert-Butyl 4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)indoline-1-carboxylate and tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate, among others.
What is the molecular weight of the compound?
The molecular weight is 345.2 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C19H28BNO4/c1-17(2,3)23-16(22)21-12-11-13-14(9-8-10-15(13)21)20-24-18(4,5)19(6,7)25-20/h8-10H,11-12H2,1-7H3.
What is the InChIKey of the compound?
The InChIKey is JNLQPCDEHQJZLY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C3CCN(C3=CC=C2)C(=O)OC(C)(C)C.
What is the CAS number of the compound?
The CAS number is 1235451-62-3.
What is the hydrogen bond donor count of the compound?
The compound has zero hydrogen bond donors.
What is the topological polar surface area of the compound?
The topological polar surface area is 48Ų.
※ Please kindly note that our products are for research use only.