1-Methyl-2-(methylthio)imidazole

• CAS: 14486-52-3
• Catalog Number: ACM14486523
• Category: Other Products
• Molecular Weight: 128.19542
• Molecular Formula: C₅H₈N₂S
• Synonyms: 1-Methyl-2-(Methylthio)iMidazole;1-Methyl-2-(methylsulphanyl)-1H-imidazole;1-METHYL-2-(METHYLTHIO)IMIDAZOLE(2MMI);2-Methylthio-3-methylimidazole

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-methyl-2-methylsulfanylimidazole.

What is the molecular formula of the compound?

The molecular formula of the compound is C5H8N2S.

What is the molecular weight of the compound?

The molecular weight of the compound is 128.20 g/mol.

What is the CAS number of the compound?

The CAS number of the compound is 14486-52-3.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C5H8N2S/c1-7-4-3-6-5(7)8-2/h3-4H,1-2H3.

How many hydrogen bond donor atoms are present in the compound?

There are no hydrogen bond donor atoms in the compound.

How many hydrogen bond acceptor atoms are present in the compound?

There are 2 hydrogen bond acceptor atoms in the compound.

How many rotatable bonds are present in the compound?

There is 1 rotatable bond in the compound.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 43.1 ?2.

Is the compound canonically represented?

Yes, the compound is canonically represented.