What is the molecular formula of 1-Hydrazino-2-propanol?
The molecular formula of 1-Hydrazino-2-propanol is C3H10N2O.
What is the molecular weight of 1-Hydrazino-2-propanol?
The molecular weight of 1-Hydrazino-2-propanol is 90.12 g/mol.
What is the IUPAC name of 1-Hydrazino-2-propanol?
The IUPAC name of 1-Hydrazino-2-propanol is 1-hydrazinylpropan-2-ol.
What is the InChI of 1-Hydrazino-2-propanol?
The InChI of 1-Hydrazino-2-propanol is InChI=1S/C3H10N2O/c1-3(6)2-5-4/h3,5-6H,2,4H2,1H3.
What is the InChIKey of 1-Hydrazino-2-propanol?
The InChIKey of 1-Hydrazino-2-propanol is OWXTVVMIMIRMLL-UHFFFAOYSA-N.
What is the CAS number of 1-Hydrazino-2-propanol?
The CAS number of 1-Hydrazino-2-propanol is 18501-20-7.
What is the EC number of 1-Hydrazino-2-propanol?
The EC number of 1-Hydrazino-2-propanol is 833-904-6.
What is the DSSTox Substance ID of 1-Hydrazino-2-propanol?
The DSSTox Substance ID of 1-Hydrazino-2-propanol is DTXSID10284677.
What is the XLogP3-AA value of 1-Hydrazino-2-propanol?
The XLogP3-AA value of 1-Hydrazino-2-propanol is -1.2.
Is 1-Hydrazino-2-propanol a canonicalized compound?
Yes, 1-Hydrazino-2-propanol is a canonicalized compound.