What is the PubChem CID number for 1-Ethynylcyclohexylamine?
The PubChem CID number for 1-Ethynylcyclohexylamine is 121691.
What is the molecular formula of 1-Ethynylcyclohexylamine?
The molecular formula of 1-Ethynylcyclohexylamine is C8H13N.
What is the molecular weight of 1-Ethynylcyclohexylamine?
The molecular weight of 1-Ethynylcyclohexylamine is 123.20 g/mol.
What is the IUPAC name of 1-Ethynylcyclohexylamine?
The IUPAC name of 1-Ethynylcyclohexylamine is 1-ethynylcyclohexan-1-amine.
What is the InChI of 1-Ethynylcyclohexylamine?
The InChI of 1-Ethynylcyclohexylamine is InChI=1S/C8H13N/c1-2-8(9)6-4-3-5-7-8/h1H,3-7,9H2.
What is the Canonical SMILES of 1-Ethynylcyclohexylamine?
The Canonical SMILES of 1-Ethynylcyclohexylamine is C#CC1(CCCCC1)N.
What is the CAS number of 1-Ethynylcyclohexylamine?
The CAS number of 1-Ethynylcyclohexylamine is 30389-18-5.
What is the European Community (EC) Number of 1-Ethynylcyclohexylamine?
The European Community (EC) Number of 1-Ethynylcyclohexylamine is 250-172-8.
What is the UNII of 1-Ethynylcyclohexylamine?
The UNII of 1-Ethynylcyclohexylamine is Z445AV6Q6J.
Is 1-Ethynylcyclohexylamine a canonicalized compound?
Yes, 1-Ethynylcyclohexylamine is a canonicalized compound.