What is the molecular formula of 1-Ethynyl-1-cyclohexanol?
The molecular formula of 1-Ethynyl-1-cyclohexanol is C8H12O.
What is the molecular weight of 1-Ethynyl-1-cyclohexanol?
The molecular weight of 1-Ethynyl-1-cyclohexanol is 124.18 g/mol.
What is the IUPAC name of 1-Ethynyl-1-cyclohexanol?
The IUPAC name of 1-Ethynyl-1-cyclohexanol is 1-ethynylcyclohexan-1-ol.
What is the InChI of 1-Ethynyl-1-cyclohexanol?
The InChI of 1-Ethynyl-1-cyclohexanol is InChI=1S/C8H12O/c1-2-8(9)6-4-3-5-7-8/h1,9H,3-7H2.
What is the InChIKey of 1-Ethynyl-1-cyclohexanol?
The InChIKey of 1-Ethynyl-1-cyclohexanol is QYLFHLNFIHBCPR-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Ethynyl-1-cyclohexanol?
The canonical SMILES of 1-Ethynyl-1-cyclohexanol is C#CC1(CCCCC1)O.
What is the CAS number of 1-Ethynyl-1-cyclohexanol?
The CAS number of 1-Ethynyl-1-cyclohexanol is 78-27-3.
What is the XLogP3 value of 1-Ethynyl-1-cyclohexanol?
The XLogP3 value of 1-Ethynyl-1-cyclohexanol is 1.7.
How many hydrogen bond donor counts does 1-Ethynyl-1-cyclohexanol have?
1-Ethynyl-1-cyclohexanol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1-Ethynyl-1-cyclohexanol have?
1-Ethynyl-1-cyclohexanol has 1 hydrogen bond acceptor count.