What is the molecular formula of 1-Ethylpropylamine?
The molecular formula of 1-Ethylpropylamine is C5H13N.
What is the molecular weight of 1-Ethylpropylamine?
The molecular weight of 1-Ethylpropylamine is 87.16 g/mol.
What are some synonyms for 1-Ethylpropylamine?
Some synonyms for 1-Ethylpropylamine are 3-AMINOPENTANE, pentan-3-amine, 616-24-0, and 3-Pentanamine.
What is the IUPAC name of 1-Ethylpropylamine?
The IUPAC name of 1-Ethylpropylamine is pentan-3-amine.
What is the InChI of 1-Ethylpropylamine?
The InChI of 1-Ethylpropylamine is InChI=1S/C5H13N/c1-3-5(6)4-2/h5H,3-4,6H2,1-2H3.
What is the InChIKey of 1-Ethylpropylamine?
The InChIKey of 1-Ethylpropylamine is PQPFFKCJENSZKL-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Ethylpropylamine?
The canonical SMILES of 1-Ethylpropylamine is CCC(CC)N.
What is the CAS number of 1-Ethylpropylamine?
The CAS number of 1-Ethylpropylamine is 616-24-0.
What is the topological polar surface area of 1-Ethylpropylamine?
The topological polar surface area of 1-Ethylpropylamine is 26Ų.