What is the molecular formula of 1-ethyl-3-methylimidazolium dimethylphosphate?
The molecular formula is C8H17N2O4P.
What are the synonyms of 1-ethyl-3-methylimidazolium dimethylphosphate?
The synonyms include 945611-27-8, 1-ethyl-3-methylimidazolium dimethyl phosphate, 1-Ethyl-3-methylimidazolium dimethylphosphate, and 3-Ethyl-1-methyl-1H-imidazol-3-ium dimethyl phosphate.
What is the molecular weight of 1-ethyl-3-methylimidazolium dimethylphosphate?
The molecular weight is 236.21 g/mol.
What are the component compounds of 1-ethyl-3-methylimidazolium dimethylphosphate?
The component compounds are Dimethyl hydrogen phosphate (CID 13134) and 1-Ethyl-3-methylimidazolium (CID 174076).
What is the IUPAC name of 1-ethyl-3-methylimidazolium dimethylphosphate?
The IUPAC name is dimethyl phosphate;1-ethyl-3-methylimidazol-3-ium.
What is the InChI of 1-ethyl-3-methylimidazolium dimethylphosphate?
The InChI is InChI=1S/C6H11N2.C2H7O4P/c1-3-8-5-4-7(2)6-8;1-5-7(3,4)6-2/h4-6H,3H2,1-2H3;1-2H3,(H,3,4)/q+1;/p-1.
What is the InChIKey of 1-ethyl-3-methylimidazolium dimethylphosphate?
The InChIKey is WTKUDOCGUOSPGV-UHFFFAOYSA-M.
What is the canonical SMILES of 1-ethyl-3-methylimidazolium dimethylphosphate?
The canonical SMILES is CCN1C=C[N+](=C1)C.COP(=O)([O-])OC.
What is the CAS number of 1-ethyl-3-methylimidazolium dimethylphosphate?
The CAS number is 945611-27-8.
※ Please kindly note that our products are for research use only.