What is the molecular formula of 1-Ethoxy-2-propanol?
The molecular formula of 1-Ethoxy-2-propanol is C5H12O2.
What is the molecular weight of 1-Ethoxy-2-propanol?
The molecular weight of 1-Ethoxy-2-propanol is 104.15 g/mol.
What is the IUPAC name of 1-Ethoxy-2-propanol?
The IUPAC name of 1-Ethoxy-2-propanol is 1-ethoxypropan-2-ol.
What is the InChI of 1-Ethoxy-2-propanol?
The InChI of 1-Ethoxy-2-propanol is InChI=1S/C5H12O2/c1-3-7-4-5(2)6/h5-6H,3-4H2,1-2H3.
What is the InChIKey of 1-Ethoxy-2-propanol?
The InChIKey of 1-Ethoxy-2-propanol is JOLQKTGDSGKSKJ-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Ethoxy-2-propanol?
The canonical SMILES of 1-Ethoxy-2-propanol is CCOCC(C)O.
What is the CAS number of 1-Ethoxy-2-propanol?
The CAS number of 1-Ethoxy-2-propanol is 1569-02-4.
What is the EC number of 1-Ethoxy-2-propanol?
The EC number of 1-Ethoxy-2-propanol is 216-374-5.
How many hydrogen bond acceptor counts does 1-Ethoxy-2-propanol have?
1-Ethoxy-2-propanol has 2 hydrogen bond acceptor counts.