What is the molecular formula of 1-Cyclopentyl-ethanone?
The molecular formula of 1-Cyclopentyl-ethanone is C7H12O.
What is the molecular weight of 1-Cyclopentyl-ethanone?
The molecular weight of 1-Cyclopentyl-ethanone is 112.17 g/mol.
What is the IUPAC name of 1-Cyclopentyl-ethanone?
The IUPAC name of 1-Cyclopentyl-ethanone is 1-cyclopentylethanone.
What is the InChI of 1-Cyclopentyl-ethanone?
The InChI of 1-Cyclopentyl-ethanone is InChI=1S/C7H12O/c1-6(8)7-4-2-3-5-7/h7H,2-5H2,1H3.
What is the InChIKey of 1-Cyclopentyl-ethanone?
The InChIKey of 1-Cyclopentyl-ethanone is LKENTYLPIUIMFG-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Cyclopentyl-ethanone?
The canonical SMILES of 1-Cyclopentyl-ethanone is CC(=O)C1CCCC1.
What is the CAS number of 1-Cyclopentyl-ethanone?
The CAS number of 1-Cyclopentyl-ethanone is 6004-60-0.
What is the EC number of 1-Cyclopentyl-ethanone?
The EC number of 1-Cyclopentyl-ethanone is 831-763-5.
What is the UNII of 1-Cyclopentyl-ethanone?
The UNII of 1-Cyclopentyl-ethanone is N7CM8FC0UL.
Is 1-Cyclopentyl-ethanone a canonicalized compound?
Yes, 1-Cyclopentyl-ethanone is a canonicalized compound.