What is the chemical formula of 1-Chloro-4-propylbenzene?
The chemical formula of 1-Chloro-4-propylbenzene is C9H11Cl.
What is the molecular weight of 1-Chloro-4-propylbenzene?
The molecular weight of 1-Chloro-4-propylbenzene is 154.63 g/mol.
What is the IUPAC name of 1-Chloro-4-propylbenzene?
The IUPAC name of 1-Chloro-4-propylbenzene is 1-chloro-4-propylbenzene.
What is the InChI of 1-Chloro-4-propylbenzene?
The InChI of 1-Chloro-4-propylbenzene is InChI=1S/C9H11Cl/c1-2-3-8-4-6-9(10)7-5-8/h4-7H,2-3H2,1H3.
What is the InChIKey of 1-Chloro-4-propylbenzene?
The InChIKey of 1-Chloro-4-propylbenzene is QXQAPNSHUJORMC-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Chloro-4-propylbenzene?
The canonical SMILES of 1-Chloro-4-propylbenzene is CCCC1=CC=C(C=C1)Cl.
What is the CAS number of 1-Chloro-4-propylbenzene?
The CAS number of 1-Chloro-4-propylbenzene is 52944-34-0.
What is the European Community (EC) Number of 1-Chloro-4-propylbenzene?
The European Community (EC) Number of 1-Chloro-4-propylbenzene is 674-009-9.
What is the molecular weight of 1-Chloro-4-propylbenzene according to PubChem?
The molecular weight of 1-Chloro-4-propylbenzene according to PubChem is 154.63 g/mol.
Is 1-Chloro-4-propylbenzene a canonicalized compound?
Yes, 1-Chloro-4-propylbenzene is a canonicalized compound according to PubChem.