What is the molecular formula of 1-Chloro-4-ethylbenzene?
The molecular formula of 1-Chloro-4-ethylbenzene is C8H9Cl.
What is the molecular weight of 1-Chloro-4-ethylbenzene?
The molecular weight of 1-Chloro-4-ethylbenzene is 140.61 g/mol.
What is the IUPAC name of 1-Chloro-4-ethylbenzene?
The IUPAC name of 1-Chloro-4-ethylbenzene is 1-chloro-4-ethylbenzene.
What is the InChI of 1-Chloro-4-ethylbenzene?
The InChI of 1-Chloro-4-ethylbenzene is InChI=1S/C8H9Cl/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3.
What is the InChIKey of 1-Chloro-4-ethylbenzene?
The InChIKey of 1-Chloro-4-ethylbenzene is GPOFSFLJOIAMSA-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1-Chloro-4-ethylbenzene?
The canonical SMILES representation of 1-Chloro-4-ethylbenzene is CCC1=CC=C(C=C1)Cl.
What is the CAS number of 1-Chloro-4-ethylbenzene?
The CAS number of 1-Chloro-4-ethylbenzene is 622-98-0.
What is the European Community (EC) number of 1-Chloro-4-ethylbenzene?
The European Community (EC) number of 1-Chloro-4-ethylbenzene is 210-763-3.
What is the UNII of 1-Chloro-4-ethylbenzene?
The UNII of 1-Chloro-4-ethylbenzene is RG9SR6EV5J.
Is 1-Chloro-4-ethylbenzene a canonical compound?
Yes, 1-Chloro-4-ethylbenzene is a canonical compound.