What is the molecular formula of 1-butyl-3-vinylimidazolium hexafluorophosphate?
The molecular formula is C9H15F6N2P.
What are some synonyms for 1-butyl-3-vinylimidazolium hexafluorophosphate?
Some synonyms include 915358-85-9, 1-BUTYL-3-VINYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE, and F71432.
What is the molecular weight of 1-butyl-3-vinylimidazolium hexafluorophosphate?
The molecular weight is 296.19 g/mol.
What is the IUPAC name of 1-butyl-3-vinylimidazolium hexafluorophosphate?
The IUPAC name is 1-butyl-3-ethenylimidazol-1-ium;hexafluorophosphate.
What is the InChI of 1-butyl-3-vinylimidazolium hexafluorophosphate?
The InChI is InChI=1S/C9H15N2.F6P/c1-3-5-6-11-8-7-10(4-2)9-11;1-7(2,3,4,5)6/h4,7-9H,2-3,5-6H2,1H3;/q+1;-1.
What is the InChIKey of 1-butyl-3-vinylimidazolium hexafluorophosphate?
The InChIKey is MKBDPJXUWZOHCB-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-butyl-3-vinylimidazolium hexafluorophosphate?
The Canonical SMILES is CCCC[N+]1=CN(C=C1)C=C.F[P-](F)(F)(F)(F)F.
What are the computed properties of 1-butyl-3-vinylimidazolium hexafluorophosphate?
The computed properties include the molecular weight (296.19 g/mol), hydrogen bond donor count (0), hydrogen bond acceptor count (7), rotatable bond count (4), exact mass (296.08770446 g/mol), monoisotopic mass (296.08770446 g/mol), topological polar surface area (8.8?2), heavy atom count (18), formal charge (0), complexity (186), isotope atom count (0), defined atom stereocenter count (0), undefined atom stereocenter count (0), defined bond stereocenter count (0), undefined bond stereocenter count (0), covalently-bonded unit count (2), and whether the compound is canonicalized (Yes).
How was the molecular weight computed for 1-butyl-3-vinylimidazolium hexafluorophosphate?
The molecular weight was computed using PubChem 2.1.
What is the modification date of the information on 1-butyl-3-vinylimidazolium hexafluorophosphate?
The modification date is 2023-12-30.
※ Please kindly note that our products are for research use only.