What is the molecular formula of 1-Bromohenicosafluorodecane?
The molecular formula of 1-Bromohenicosafluorodecane is BrC10F21C10BrF21.
What are some synonyms of 1-Bromohenicosafluorodecane?
Some synonyms of 1-Bromohenicosafluorodecane are Perflubrodec, PERFLUORODECYL BROMIDE, and Perflubrodec [INN].
What is the molecular weight of 1-Bromohenicosafluorodecane?
The molecular weight of 1-Bromohenicosafluorodecane is 598.98 g/mol.
When was 1-Bromohenicosafluorodecane created and modified?
1-Bromohenicosafluorodecane was created on August 8, 2005, and modified on October 21, 2023.
What is the IUPAC name of 1-Bromohenicosafluorodecane?
The IUPAC name of 1-Bromohenicosafluorodecane is 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane.
What is the InChI of 1-Bromohenicosafluorodecane?
The InChI of 1-Bromohenicosafluorodecane is InChI=1S/C10BrF21/c11-9(28,29)7(24,25)5(20,21)3(16,17)1(12,13)2(14,15)4(18,19)6(22,23)8(26,27)10(30,31)32.
What is the InChIKey of 1-Bromohenicosafluorodecane?
The InChIKey of 1-Bromohenicosafluorodecane is JCAULFRGWRHHIG-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-Bromohenicosafluorodecane?
The Canonical SMILES of 1-Bromohenicosafluorodecane is C(C(C(C(C(C(F)(F)Br)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F.
What is the CAS number of 1-Bromohenicosafluorodecane?
The CAS number of 1-Bromohenicosafluorodecane is 307-43-7.
What is the European Community (EC) number of 1-Bromohenicosafluorodecane?
The European Community (EC) number of 1-Bromohenicosafluorodecane is 206-201-1.