1-Benzhydrylhydrazine hydrochloride

• CAS: 96329-22-5
• Catalog Number: ACM96329225
• Category: Other Products
• Molecular Weight: 234.7246
• Molecular Formula: C₁₃H₁₅ClN₂
• Synonyms: 1-benzhydrylhydrazine hydrochloride

Custom Q&A

What is the molecular formula of 1-Benzhydrylhydrazine hydrochloride according to the reference?

The molecular formula is C13H15ClN2.

What is the molecular weight of 1-Benzhydrylhydrazine hydrochloride?

The molecular weight is 234.72 g/mol.

What are some synonyms for 1-Benzhydrylhydrazine hydrochloride?

Some synonyms include Benzhydrylhydrazine hydrochloride, 1-benzhydrylhydrazine hydrochloride, and (diphenylmethyl)hydrazine hydrochloride.

What is the IUPAC name of 1-Benzhydrylhydrazine hydrochloride?

The IUPAC name is benzhydrylhydrazine;hydrochloride.

What is the InChI of 1-Benzhydrylhydrazine hydrochloride?

The InChI is InChI=1S/C13H14N2.ClH/c14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13,15H,14H2;1H.

What is the canonical SMILES of 1-Benzhydrylhydrazine hydrochloride?

The canonical SMILES is C1=CC=C(C=C1)C(C2=CC=CC=C2)NN.Cl.

What is the CAS number of 1-Benzhydrylhydrazine hydrochloride?

The CAS number is 96329-22-5.

How many hydrogen bond donor count does 1-Benzhydrylhydrazine hydrochloride have?

It has 3 hydrogen bond donor counts.

What is the topological polar surface area of 1-Benzhydrylhydrazine hydrochloride?

The topological polar surface area is 382.

Is 1-Benzhydrylhydrazine hydrochloride considered canonicalized?

Yes, it is considered canonicalized.