The molecular formula of the compound is C8H12ClNO2.
What is the PubChem CID of the compound?
The PubChem CID of the compound is 18525997.
What are the synonyms of the compound?
The synonyms of the compound include 3839-39-2, 1-[(aminooxy)methyl]-3-methoxybenzene hydrochloride, O-(3-Methoxybenzyl)hydroxylamine hydrochloride, and O-[(3-methoxyphenyl)methyl]hydroxylamine;hydrochloride.
What is the molecular weight of the compound?
The molecular weight of the compound is 189.64 g/mol.
Who computed the molecular weight of the compound?
The molecular weight of the compound was computed by PubChem.
What is the IUPAC name of the compound?
The IUPAC name of the compound is O-[(3-methoxyphenyl)methyl]hydroxylamine;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H11NO2.ClH/c1-10-8-4-2-3-7(5-8)6-11-9;/h2-5H,6,9H2,1H3;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is DNGAZMVOQCQJIG-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=CC=CC(=C1)CON.Cl.
What is the ChEMBL ID of the compound?
The ChEMBL ID of the compound is CHEMBL3764222.
※ Please kindly note that our products are for research use only.